Identification |
Name: | 2-Aminophenylboronic acid |
Synonyms: | Benzeneboronicacid, o-amino- (7CI,8CI);Boronic acid, (2-aminophenyl)- (9CI);o-Aminophenylboronicacid; |
CAS: | 5570-18-3 |
Molecular Formula: | C6H8BNO2 |
Molecular Weight: | 136.94 |
InChI: | InChI=1/C18H21N3O3/c1-13-4-6-15(7-5-13)19-12-18(22)21-20-11-14-10-16(23-2)8-9-17(14)24-3/h4-11,19H,12H2,1-3H3,(H,21,22)/b20-11- |
Molecular Structure: |
|
Properties |
Melting Point: | 188-190ºC |
Flash Point: | 163.6 ºC |
Boiling Point: | 346.9ºC at 760 mmHg |
Density: | 1.23 g/cm3 |
Refractive index: | 1.558 |
Specification: | Crystalline powder Safety Statements:26-36/37/39-37-36 26:In case of contact with eyes, rinse immediately with plenty
of water and seek medical advice 36/37/39:Wear suitable protective clothing, gloves and eye/face
protection 37:Wear suitable gloves 36:Wear suitable protective clothing |
HS Code: | 29310095 |
Flash Point: | 163.6 ºC |
Safety Data |
Hazard Symbols |
Xn: Harmful
Xi: Irritant
|
|
|