| Identification | |
| Name: | Diethylstilbestrol |
| CAS: | 56-53-1 |
| EINECS: | 200-278-5 |
| Molecular Formula: | C18H20O2 |
| Molecular Weight: | 268.35 |
| InChI: | InChI=1/C18H20O2/c1-3-17(13-5-9-15(19)10-6-13)18(4-2)14-7-11-16(20)12-8-14/h5-12,19-20H,3-4H2,1-2H3/b18-17+ |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 3077 |
| Density: | 1.107g/cm3 |
| Stability: | No data. |
| Refractive index: | 1.5299 |
| Water Solubility: | PRACTICALLY INSOLUBLE |
| Solubility: | PRACTICALLY INSOLUBLE |
| Appearance: | white crystalline powder |
| Packinggroup: | III |
| Color: | White crystalline powder Small plates from benzene |
| Usage: | A synthetic, nonsteroidal estrogen. Recomended solvents are DMSO, DMF and ethanol, even in these solvents do not store in solution for any prolonged period of time. |
| Safety Data | |
| Hazard Symbols |
T:Toxic
|
 |
|
