| Identification | |
| Name: | Diethylstilbestrol dimethyl ether |
| CAS: | 7773-34-4 |
| EINECS: | 231-872-2 |
| Molecular Formula: | C20H24O2 |
| Molecular Weight: | 296.4 |
| InChI: | InChI=1/C20H24O2/c1-5-19(15-7-11-17(21-3)12-8-15)20(6-2)16-9-13-18(22-4)14-10-16/h7-14H,5-6H2,1-4H3 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 153°C |
| Boiling Point: | 419.6°C at 760 mmHg |
| Density: | 1.01g/cm3 |
| Refractive index: | 1.545 |
| Specification: |
Diethylstilbestrol dimethyl ether , its cas register number is 7773-34-4. It also can be called 3,4-Bis(4-methoxyphenyl)hex-3-ene ; 3-Hexene, 3,4-bis(4-methoxyphenyl)- ; and Benzene, 1,1'-(1,2-diethyl-1,2-ethenediyl)bis(4-methoxy- (9CI) . |
| Flash Point: | 153°C |
| Safety Data | |
 |
|
