| Identification | |
| Name: | 1,1-Dichloro-1-propene |
| Synonyms: | 1,1-dichloro-1-propen;1,1-dichloro-prop-1-ene;1,1-dichloro-propen;1,1-dichloropropenesinglecomponent*standardfor;1,1-Dichloropropylene;1,1-Dichlorpropen;1-propene,1,1-dichloro;1-Propene,1,1-dichloro- |
| CAS: | 563-58-6 |
| EINECS: | 209-253-3 |
| Molecular Formula: | C3H4Cl2 |
| Molecular Weight: | 0 |
| InChI: | InChI=1/C3H4Cl2/c1-2-3(4)5/h2H,1H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | 2047 |
| Flash Point: | 11°C |
| Boiling Point: | 78.1°Cat760mmHg |
| Density: | 1.177g/cm3 |
| Specification: | Safety Statements:16-26-36/37/39-61-45-33-29-36/37-7 16:Keep away from sources of ignition - No smoking 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36/37/39:Wear suitable protective clothing, gloves and eye/face protection 61:Avoid release to the environment. Refer to special instructions safety data sheet 45:In case of accident or if you feel unwell, seek medical advice immediately (show label where possible) 33:Take precautionary measures against static discharges 29:Do not empty into drains 36/37:Wear suitable protective clothing and gloves 7:Keep container tightly closed |
| Packinggroup: | II |
| Flash Point: | 11°C |
| Storage Temperature: | Refrigerator |
| Safety Data | |
 |
|
