| Identification | |
| Name: | 1-Propene,1,2-dichloro-, (1Z)- (9CI) |
| Synonyms: | 1-Propene,1,2-dichloro-, (Z)-; Propene, 1,2-dichloro-, (Z)- (8CI);(Z)-1,2-Dichloro-1-propene; (Z)-1,2-Dichloropropene; cis-1,2-Dichloro-1-propene;cis-1,2-Dichloropropylene; cis-Dichloropropene |
| CAS: | 6923-20-2 |
| Molecular Formula: | C3H4 Cl2 |
| Molecular Weight: | 0 |
| InChI: | InChI=1S/C3H4Cl2/c1-3(5)2-4/h2H,1H3/b3-2- |
| Molecular Structure: |  |
| Properties | |
| Boiling Point: | 108 deg C |
| Solubility: | Miscible with hydrocarbons, halogenated solvents, esters, and ketones. Soluble in toluene, acetone, octane. In water, 2,800 mg/l @ 20 deg C |
| Color: | Amber liquid Colorless to straw-colored liquid |
| Safety Data | |
 |
|
