| Identification | |
| Name: | Methyl Isopropyl Ketone |
| Synonyms: | 3-Methyl-2-butanone; 3-Methyl Butan-2-one; Isopropyl Methyl Ketone; Methyl-2-butanone; METHYL ISOPROPYL KETONE (3-METHYL-2-BUTANONE); MIPK |
| CAS: | 563-80-4 |
| EINECS: | 209-264-3 |
| Molecular Formula: | C5H10O |
| Molecular Weight: | 86.13 |
| InChI: | InChI=1/C5H10O/c1-4(2)5(3)6/h4H,1-3H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 2397 |
| Density: | 0.805 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.387-1.389 |
| Solubility: | 6 g/L |
| Appearance: | colorless to pale yellow liquid |
| Specification: |
3-Methyl-2-butanone (CAS NO.563-80-4) is a highly flammable liquid ketone, so you should keep it far away from fire. besides, it will explosive when mixed with combustible material. |
| Packinggroup: | II |
| HS Code: | 29141990 |
| Storage Temperature: | Flammables area |
| Usage: | Often used as a solvent. |
| Safety Data | |
| Hazard Symbols |
F:Flammable
|
 |
|
