| Identification | |
| Name: | D-Plenylglycinol |
| Synonyms: | Benzeneethanol,b-amino-, (R)-;(-)-(R)-b-Aminobenzeneethanol;(-)-2-Amino-2-phenylethanol;(-)-Phenylglycinol;(2R)-2-Amino-2-phenylethanol;(R)-(-)-2-Amino-2-phenylethanol;(R)-(-)-2-Phenyl-2-aminoethanol;(R)-(-)-2-Phenylglycinol;(R)-(-)-Phenylglycinol;(R)-2-Amino-2-phenylethanol;(R)-2-Phenylglycinol;(R)-Phenylglycinol;(R)-a-Phenylglycinol;(bR)-b-Aminobenzeneethanol;D-(-)-2-Amino-2-phenylethanol;D-(-)-a-Phenylglycinol;D-a-Phenylglycinol;R-(-)-a-Phenylglycinol;[(R)-2-Hydroxy-1-phenylethyl]amine;R(-)-2-Phenylglycinol;D-Phg-ol; |
| CAS: | 56613-80-0 |
| EINECS: | 260-287-5 |
| Molecular Formula: | C8H11NO |
| Molecular Weight: | 137.18 |
| InChI: | InChI=1/C8H11NO/c9-8(6-10)7-4-2-1-3-5-7/h1-5,8,10H,6,9H2 |
| Molecular Structure: |  |
| Properties | |
| Transport: | OTH |
| Density: | 1.104g/cm3 |
| Stability: | Stable under normal temperatures and pressures. |
| Alpha: | -25.5 o (C=6,MEOH) |
| Appearance: | white to light yellow crystal powde |
| Specification: |
?D-Plenylglycinol , with CAS number of 56613-80-0, can be called Benzeneethanol,b-amino-, (R)- ; (-)-(R)-b-Aminobenzeneethanol ; (2R)-2-Amino-2-phenyl-1-ethanol ; (R)-(-)-2-Amino-2-phenylethanol ; (R)-Phenylglycinol ; (bR)-b-Aminobenzeneethanol ; D-(-)-2-Amino-2-phenylethanol ; [(R)-2-Hydroxy-1-phenylethyl]amine . It is a?white to light yellow crystal powde. |
| HS Code: | 29221980 |
| Sensitive: | Air Sensitive |
| Safety Data | |
| Hazard Symbols |
T: Toxic
C: Corrosive
|
 |
|
