Identification |
Name: | rac 1-Chloro-3-[4-(2-methoxyethyl)phenoxy]-2-propanol |
Synonyms: | rac 1-Chloro-3-[4-(2-methoxyethyl)phenoxy]-2-propanol |
CAS: | 56718-76-4 |
Molecular Formula: | C12H17ClO3 |
Molecular Weight: | 0 |
InChI: | InChI=1/C12H17ClO3/c1-15-7-6-10-2-4-12(5-3-10)16-9-11(14)8-13/h2-5,11,14H,6-9H2,1H3 |
Molecular Structure: |
![(C12H17ClO3) rac 1-Chloro-3-[4-(2-methoxyethyl)phenoxy]-2-propanol](https://img1.guidechem.com/structure/image/56718-76-4.png) |
Properties |
Flash Point: | 174.2°C |
Boiling Point: | 364.5°C at 760 mmHg |
Density: | 1.157g/cm3 |
Refractive index: | 1.521 |
Flash Point: | 174.2°C |
Usage: | An intermediate for the synthesis of -chlorohydrins and -chloroamines. |
Safety Data |
|
 |