| Identification | |
| Name: | 2-Propanol,1-[4-(2-methoxyethyl)phenoxy]-3-[(1-methylethyl)amino]-, (2R)- |
| Synonyms: | 2-Propanol,1-[4-(2-methoxyethyl)phenoxy]-3-[(1-methylethyl)amino]-, (R)-; (+)-Metoprolol;(R)-(+)-Metoprolol; (R)-Metoprolol |
| CAS: | 81024-43-3 |
| Molecular Formula: | C15H25 N O3 |
| Molecular Weight: | 267.36 |
| InChI: | InChI=1/C15H25NO3/c1-12(2)16-10-14(17)11-19-15-6-4-13(5-7-15)8-9-18-3/h4-7,12,14,16-17H,8-11H2,1-3H3/t14-/m1/s1 |
| Molecular Structure: | ![(C15H25NO3) 2-Propanol,1-[4-(2-methoxyethyl)phenoxy]-3-[(1-methylethyl)amino]-, (R)-; (+)-Metoprolol;(R)-(+)-Met...](https://img1.guidechem.com/chem/e/dict/39/81024-43-3.jpg) |
| Properties | |
| Flash Point: | 194.9°C |
| Boiling Point: | 398.6°C at 760 mmHg |
| Density: | 1.033g/cm3 |
| Refractive index: | 1.507 |
| Specification: | Light Beige Waxy Solid usageEng:(R)-Enantiomer of Metoprolol. Antihypertensive; antianginal; antiarrhythmic (class II) |
| Flash Point: | 194.9°C |
| Usage: | (R)-Enantiomer of Metoprolol. Antihypertensive; antianginal; antiarrhythmic (class II) |
| Safety Data | |
 |
|
