| Identification | |
| Name: | 1-Bromo-2,3-dichlorobenzene |
| Synonyms: | 2,3-Dichlorobromobenzene |
| CAS: | 56961-77-4 |
| EINECS: | 260-476-2 |
| Molecular Formula: | C6H3BrCl2 |
| Molecular Weight: | 225.9 |
| InChI: | InChI=1/C6H3BrCl2/c7-4-2-1-3-5(8)6(4)9/h1-3H |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.744 g/cm3 |
| Stability: | Stable at room temperature in closed containers under normal storage and handling conditions. |
| Refractive index: | 1.59 |
| Water Solubility: | insoluble |
| Solubility: | insoluble |
| Appearance: | Slightly yellow crystalline powder. |
| Specification: |
1-Bromo-2,3-dichlorobenzene , with CAS number of 56961-77-4, can be called 2,3-Dichlorobromobenzene ; 2,3-dichloro-1-bromobenzene ; 1-bromo-2,3-dichlorobenzene ; benzene, 1-bromo-2,3-dichloro- ; 1-bromo-2,3-dichlorobenzene,>98% ; 1-bromo-2,3-dichlorobenzene 98% ; 1,2-Dichloro-3-bromobenzene ; 1-Bromo-2,3-dichlorobenzene,99% . It is a light yellow crystalline flake. |
| Packinggroup: | I; II; III |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
