| Identification | |
| Name: | 1-Bromo-3,4-dichlorobenzene |
| Synonyms: | 3,4-Dichloro-1-bromobenzene;3,4-Dichlorobromobenzene;4-Bromo-1,2-dichlorobenzene; |
| CAS: | 18282-59-2 |
| EINECS: | 242-160-6 |
| Molecular Formula: | C6H3BrCl2 |
| Molecular Weight: | 225.9 |
| InChI: | InChI=1/C6H3BrCl2/c7-4-1-2-5(8)6(9)3-4/h1-3H |
| Molecular Structure: |  |
| Properties | |
| Stability: | Stable at room temperature in closed containers under normal storage and handling conditions. |
| Refractive index: | 1.5986-1.6006 |
| Water Solubility: | insoluble |
| Solubility: | Insoluble in water |
| Appearance: | colorless to light yellow liquid or crystal |
| Specification: |
1-Bromo-3,4-dichlorobenzene , its CAS NO. is 18282-59-2, the synonyms are 4-Bromo-1,2-dichlorobenzene ; Benzene, 4-bromo-1,2-dichloro- . |
| Packinggroup: | I; II; III |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
