| Identification | |
| Name: | 1,3-Dichlorobenzene |
| Synonyms: | 1,3-Dichloro Benzene; m-Dichloro Benzene; m-Dichlorobenzene |
| CAS: | 541-73-1 |
| EINECS: | 208-792-1 |
| Molecular Formula: | C6H4Cl2 |
| Molecular Weight: | 147 |
| InChI: | InChI=1/C6H4Cl2/c7-5-2-1-3-6(8)4-5/h1-4H |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 9255 |
| Density: | 1.288 |
| Stability: | Stability Combustible. Incompatible with strong oxidizing agents, aluminium, aluminium alloys. Moisture-sensitive. |
| Refractive index: | 1.545-1.547 |
| Solubility: | insoluble |
| Appearance: | Colorless to yellowish liquid with Aromatic odor. |
| Specification: |
?1,3-Dichlorobenzene (CAS NO.541-73-1) is incompatible with oxidizing agents and aluminum and its alloys. Above the flash point, explosive vapor-air mixtures may be formed.?It can?causes headache, drousiness, unsteadiness. Irritating to mucous membranes. EYES: Severe irritation. SKIN: Severe irritation. INGESTION: Irritation of gastric mucosa, nausea, vomiting, diarrhea, abdominal cramps and cyanosis. |
| Packinggroup: | III |
| HS Code: | 29036990 |
| Storage Temperature: | 0-6°C |
| Color: | Colorless liquid |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
N:Dangerousfortheenvironment
|
 |
|
