| Identification | |
| Name: | o-dichlorobenzene |
| Synonyms: | 1,2-Dichlorobenzene; o,p-Dichlorobenzene mixture; o-Dichlorobenzol; Dichlorobenzene, 1,2-? Dichlorobenzol; Dichloricide; dilantin db; dilatin db; dizene; chloroben; chloroden; cloroben; DCB; dowtherm e; ODB; ODCB; special termite fluid; termitkil; |
| CAS: | 95-50-1 |
| EINECS: | 202-425-9 |
| Molecular Formula: | C6H4Cl2 |
| Molecular Weight: | 147 |
| InChI: | InChI=1/C6H4Cl2/c7-5-3-1-2-4-6(5)8/h1-4H |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 1591 |
| Density: | 1.306 |
| Stability: | Stable, but possibly light sensitive. Combustible. Incompatible with oxidizing agents, aluminium, aluminium alloys. Attacks some rubbers and plastics. |
| Refractive index: | 1.55-1.552 |
| Solubility: | Insoluble SOLVENT |
| Appearance: | Colorless to yellowish liquid with Aromatic odor. |
| Packinggroup: | III |
| HS Code: | 29036100 |
| Color: | Colorless liquid Colorless to pale-yellow liquid ... |
| Usage: | Herbicide. |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
