| Identification | |
| Name: | Monosodium salt of 2,2'-methylene bis(3,4,6-trichlorophenol) |
| Synonyms: | sodium hydrogen 2,2'-methylenebis[3,4,6-trichlorophenolate];Hexachlorophene, sodium salt;2,4,5-Trichloro-6-(2,3,5-trichloro-6-sodiooxybenzyl)phenol;Sodium 2-[(2-hydroxy-3,5,6-trichlorophenyl)methyl]-3,4,6-trichlorophenolate |
| CAS: | 5736-15-2 |
| EINECS: | 227-245-8 |
| Molecular Formula: | C13H5Cl6O2 . Na |
| Molecular Weight: | 450.8672 |
| InChI: | InChI=1/C17H14N2O2/c1-21-16-9-7-13(8-10-16)11-14(12-18)17(20)19-15-5-3-2-4-6-15/h2-11H,1H3,(H,19,20)/b14-11- |
| Molecular Structure: | ![(C13H5Cl6O2.Na) sodium hydrogen 2,2'-methylenebis[3,4,6-trichlorophenolate];Hexachlorophene, sodium salt;2,4,5-Trich...](https://img.guidechem.com/crawlimg/5736-15-2.png) |
| Properties | |
| Flash Point: | 272.7°C |
| Boiling Point: | 527.3°C at 760 mmHg |
| Density: | 1.236g/cm3 |
| Refractive index: | 1.653 |
| Specification: |
Monosodium salt of 2,2'-methylene bis(3,4,6-trichlorophenol) (CAS NO.5736-15-2) is also called 2,2'-Methylenebis(3,4,6-trichlorophenol) monosodium salt ; 2,2'-Methylenebis(3,4,6-trichlorophenol) sodium salt ; Caswell No. 566A ; EPA Pesticide Chemical Code 044902 ; Hexachlorophene monosodium salt ; Isobac ; Isobac 20 ; Phenol, 2,2'-methylenebis(3,4,6-trichloro-, monosodium salt ; Sodium hydrogen 2,2'-methylenebis(3,4,6-trichlorophenolate) ; Sodium, (3,4,6-trichloro-alpha-(2,3,5-trichloro-6-hydroxyphenyl)-o-tolyl)oxy- . |
| Report: |
Chlorophenol compounds are on the Community Right-To-Know List. |
| Flash Point: | 272.7°C |
| Safety Data | |
 |
|
