| Identification | |
| Name: | 1H-Pyrazole-5-carboxylicacid, 1,3-dimethyl-, ethyl ester |
| Synonyms: | Pyrazole-5-carboxylicacid, 1,3-dimethyl-, ethyl ester (7CI,8CI);1,3-Dimethyl-5-(ethoxycarbonyl)pyrazole;Ethyl1,3-dimethyl-1H-pyrazole-5-carboxylate;Ethyl1,3-dimethyl-5-pyrazolecarboxylate;Ethyl2,5-dimethyl-2H-pyrazole-3-carboxylate; |
| CAS: | 5744-40-1 |
| Molecular Formula: | C8H12 N2 O2 |
| Molecular Weight: | 168.1931 |
| InChI: | InChI=1S/C8H12N2O2/c1-4-12-8(11)7-5-6(2)9-10(7)3/h5H,4H2,1-3H3 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.12 g/cm3 |
| Appearance: | Colorless to light yellow liquid |
| Specification: | Colorless to light yellow liqui Safety Statements:24/25-36/37/39-26-23 24/25:Avoid contact with skin and eyes 36/37/39:Wear suitable protective clothing, gloves and eye/face protection 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 23:Do not breathe gas/fumes/vapor/spray (appropriate wording to be specified by the manufacturer) |
| Safety Data | |
| Hazard Symbols |
Xn: Harmful
|
 |
|
