| Identification | |
| Name: | 1,6-Dimethylnaphthalene |
| Synonyms: | 1,6-dimethyl-naphthalen;Naphthalene, 1,6-dimethyl-;1,6-DIMETHYLNAPHTHALENE;1,6-DIMETHYLNAPHTHALENE OEKANAL, 100 MG;1,6-Dimethylnaphthalene,98% |
| CAS: | 575-43-9 |
| EINECS: | 209-385-1 |
| Molecular Formula: | C12H12 |
| Molecular Weight: | 0 |
| InChI: | InChI=1/C12H12/c1-9-6-7-12-10(2)4-3-5-11(12)8-9/h3-8H,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | −17-−16 °C(lit.) |
| Flash Point: | 112°C |
| Boiling Point: | 265-266 °C(lit.) |
| Density: | 1.002 g/mL at 25 °C(lit.) |
| Refractive index: | n20/D 1.606(lit.) |
| Solubility: | Insoluble in water; sol in ether and benzene |
| Specification: | Safety Statements:23-24/25 23:Do not breathe gas/fumes/vapor/spray (appropriate wording to be specified by the manufacturer) 24/25:Avoid contact with skin and eyes |
| Flash Point: | 112°C |
| Safety Data | |
 |
|
