| Identification |
| Name: | 1,6-Dihydroxy Naphthalene |
| Synonyms: | 1,6-Dihydroxynaphthalene; 1,6-Dihydroxynaphtalene; 1,6-Naphthalenediol; 4-Fluorothiobenzamide; (1R,2S,4R)-endo-Norborneol |
| CAS: | 575-44-0 |
| EINECS: | 209-386-7 |
| Molecular Formula: | C10H8O2 |
| Molecular Weight: | 160.16932 |
| InChI: | InChI=1S/C10H8O2/c11-8-4-5-9-7(6-8)2-1-3-10(9)12/h1-6,11-12H |
| Molecular Structure: |
 |
| Properties |
| Transport: | HAZARD |
| Flash Point: | 193.5 oC |
| Boiling Point: | 375.4 oC at 760 mmHg |
| Density: | 1.33 g/cm3 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | ? |
| Water Solubility: | slightly soluble AUTOIGNITION |
| Solubility: | slightly soluble AUTOIGNITION |
| Appearance: | off white to grey powder |
| Flash Point: | 193.5 oC |
| Storage Temperature: | Keep away from heat, sparks, and flame. |
| Safety Data |
| Hazard Symbols |
Xi:Irritant
|
| |
 |
