| Identification | |
| Name: | Butanoyl chloride,2-methyl- |
| CAS: | 57526-28-0 |
| EINECS: | 260-787-3 |
| Molecular Formula: | C5H9ClO |
| Molecular Weight: | 120.58 |
| InChI: | InChI=1/C5H9ClO/c1-3-4(2)5(6)7/h4H,3H2,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 2924 |
| Density: | 0.98 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.416-1.418 |
| Solubility: | Slightly soluble |
| Appearance: | clear colorless to light yellow liquid |
| Packinggroup: | II |
| Safety Data | |
| Hazard Symbols |
F:Flammable
C:Corrosive
|
 |
|
