| Identification | |
| Name: | Ethanone,1-(1H-indol-1-yl)- |
| Synonyms: | 1H-Indole,1-acetyl- (9CI); Indole, 1-acetyl- (6CI,7CI,8CI); 1-Acetylindole;N-Acetylindole; NSC 521758 |
| CAS: | 576-15-8 |
| EINECS: | 209-396-1 |
| Molecular Formula: | C10H9 N O |
| Molecular Weight: | 159.18 |
| InChI: | InChI=1/C10H9NO/c1-8(12)11-7-6-9-4-2-3-5-10(9)11/h2-7H,1H3 |
| Molecular Structure: |  |
| Properties | |
| Refractive index: | n20/D 1.607(lit.) |
| Appearance: | clear to light yellow liquid. |
| Specification: | clear yellow liquid after melting Safety Statements:24/25 24/25:Avoid contact with skin and eyes |
| HS Code: | 29339990 |
| Safety Data | |
 |
|
