| Identification | ||
| Name: | 2,3-Dichlorophenol | |
| Synonyms: | - | |
| CAS: | 576-24-9 | |
| EINECS: | 209-399-8 | |
| Molecular Formula: | C6H4Cl2O | |
| Molecular Weight: | 163 | |
| InChI: | InChI=1/C6H4Cl2O/c7-4-2-1-3-5(9)6(4)8/h1-3,9H | |
| Molecular Structure: |  |
|
| Properties | ||
| Transport: | UN 2020 | |
| Density: | 1.458 g/cm3 | |
| Stability: | Stable. Incompatible with oxidizing agents, acid chlorides, acid anhydrides. | |
| Water Solubility: | <0.1 g/100 mL at 20 ºC | |
| Solubility: | <0.1 g/100 mL at 20 ºC | |
| Appearance: | Brown crystals (from ligroin, benzene). | |
| Specification: | light brown crystalline solid Safety Statements:26-28-61-45-36/37/39 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 28:After contact with skin, wash immediately with plenty of ... (to be specified by the manufacturer) 61:Avoid release to the environment. Refer to special instructions safety data sheet 45:In case of accident or if you feel unwell, seek medical advice immediately (show label where possible) 36/37/39:Wear suitable protective clothing, gloves and eye/face protection | |
| Packinggroup: | III | |
| HS Code: | 29081000 | |
| Storage Temperature: | 0-6°C | |
| Color: | Crystals from ligroin and benzene | |
| Usage: | Research chemical. | |
| Safety Data | ||
| Hazard Symbols |
C:Corrosive
N:Dangerousfortheenvironment
|
|
 |
||
