| Identification |
| Name: | 2,5-Dichlorophenol |
| Synonyms: | Dichlorophenol,98%; 2,5-Dinitro Phenol |
| CAS: | 583-78-8 |
| EINECS: | 209-520-4 |
| Molecular Formula: | C6H4Cl2O |
| Molecular Weight: | 163 |
| InChI: | InChI=1/C6H4Cl2O/c7-4-1-2-5(8)6(9)3-4/h1-3,9H |
| Molecular Structure: |
 |
| Properties |
| Transport: | UN 2020 6.1/PG 3 |
| Density: | 1.458 g/cm3 |
| Stability: | Stable at room temperature in closed containers under normal storage and handling conditions. |
| Refractive index: | 1.593 |
| Solubility: | 3 g/L (20 ºC) in water |
| Appearance: | Prisms (from benzene, petroleum ether) or white crystals. |
| Packinggroup: | III |
| HS Code: | 29081000 |
| Storage Temperature: | 0-6°C |
| Color: | Prisms from benzene and petroleum ether |
| Usage: | Chemical intermediate for 3,6-dichloro-o-anisic acid, the herbicide dicamba. |
| Safety Data |
| Hazard Symbols |
Xn:Harmful
|
| |
 |
