| Identification | |
| Name: | KANOSAMINE, HYDROCHLORIDE |
| Synonyms: | KANOSAMINE, HYDROCHLORIDE;3-AMINO-3-DEOXY-GLUCOPYRANOSE HYDROCHLORIDE;3-AMINO-3-DEOXY-D-GLUCOSE, HYDROCHLORIDE;3-Amino-3-deoxy-D-glucoseHCl;kanosamine;D-GLUCOSE, 3-AMINO-3-DEOXY-;3-Amino-3-deoxy-D-glucose;(2R,3S,4S,5R)-3-amino-2,4,5,6-tetrahydroxyhexanal |
| CAS: | 576-44-3 |
| Molecular Formula: | C6H14ClNO5 |
| Molecular Weight: | 215.63 |
| InChI: | InChI=1S/C6H13NO5/c7-5(3(10)1-8)6(12)4(11)2-9/h1,3-6,9-12H,2,7H2/t3-,4+,5+,6+/m0/s1 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 274.6°C |
| Boiling Point: | 530.5°Cat760mmHg |
| Density: | 1.491g/cm3 |
| Specification: | White Crystalline Solid usageEng:An antibiotic which inhibits the growth of Saccharomyces cerevisiae and a range of human pathogenic fungi, including Candida albicans |
| Flash Point: | 274.6°C |
| Usage: | An antibiotic which inhibits the growth of Saccharomyces cerevisiae and a range of human pathogenic fungi, including Candida albicans |
| Safety Data | |
 |
|
