| Identification | |
| Name: | D-Mannitol,1,6-bis[(2-chloroethyl)amino]-1,6-dideoxy- |
| Synonyms: | Mannitol,1,6-bis[(2-chloroethyl)amino]-1,6-dideoxy-, D- (8CI);1,6-Bis(chloroethylaino)-1,6-bis-deoxy-D-mannitol; BCM; BCM (cytostatic);Mannitol mustard; Mannomustin; Mannomustine |
| CAS: | 576-68-1 |
| EINECS: | 209-404-3 |
| Molecular Formula: | C10H22 Cl2 N2 O4 |
| Molecular Weight: | 305.24 |
| InChI: | InChI=1/C10H22Cl2N2O4/c11-1-3-13-5-7(15)9(17)10(18)8(16)6-14-4-2-12/h7-10,13-18H,1-6H2/t7-,8-,9-,10-/m1/s1 |
| Molecular Structure: | ![(C10H22Cl2N2O4) Mannitol,1,6-bis[(2-chloroethyl)amino]-1,6-dideoxy-, D- (8CI);1,6-Bis(chloroethylaino)-1,6-bis-deoxy...](https://img1.guidechem.com/chem/e/dict/98/576-68-1.jpg) |
| Properties | |
| Flash Point: | 281.5°C |
| Boiling Point: | 541.9°C at 760 mmHg |
| Density: | 1.353g/cm3 |
| Refractive index: | 1.544 |
| Specification: |
Mannomustine , its cas register number is 576-68-1. It also can be called Mannitol nitrogen mustard ; and 1,6-Bis((2-chloroethyl)amino)-1,6-dideoxy-D-mannitol . |
| Flash Point: | 281.5°C |
| Safety Data | |
 |
|
