| Identification | |
| Name: | 2,3-Dimethylbenzaldehyde |
| Synonyms: | Hemellitaldehyde;Benzaldehyde,2,3-dimethyl-; |
| CAS: | 5779-93-1 |
| Molecular Formula: | C9H10O |
| Molecular Weight: | 134.18 |
| InChI: | InChI=1/C9H10O/c1-7-4-3-5-9(6-10)8(7)2/h3-6H,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 215 ºF |
| Boiling Point: | 86-88 ºC (10 mmHg) |
| Density: | 1.029 |
| Refractive index: | 1.553 |
| Appearance: | colorless transparent liquid |
| Specification: | Clear Colorless Oil usageEng:The major component of the umbel rays oil. |
| Flash Point: | 215 ºF |
| Usage: | The major component of the umbel rays oil. |
| Safety Data | |
 |
|
