| Identification | |
| Name: | 3,4-Dimethylbenzaldehyde |
| Synonyms: | Benzaldehyde, 3,4-dimethyl-; |
| CAS: | 5973-71-7 |
| EINECS: | 227-770-2 |
| Molecular Formula: | C9H10O |
| Molecular Weight: | 134.18 |
| InChI: | InChI=1/C9H10O/c1-7-3-4-9(6-10)5-8(7)2/h3-6H,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.012 |
| Stability: | No data. |
| Refractive index: | 1.549-1.551 |
| Appearance: | clear colorless to yellowish liquid |
| Specification: |
3,4-Dimethylbenzaldehyde (CAS NO.5973-71-7) is also named as Benzaldehyde, 3,4-dimethyl- . 3,4-Dimethylbenzaldehyde (CAS NO.5973-71-7) is clear colorless to yellowish liquid. |
| Storage Temperature: | Store in a cool, dry place. Store in a tightly closed container. |
| Sensitive: | Air Sensitive |
| Safety Data | |
| Hazard Symbols |
Xi: Irritant
|
 |
|
