Identification |
Name: | 2-Propenoic acid, 2-methyl-, methyl ester, polymer with butyl 2-propenoate and 1,2-propanediol mono(2-methyl-2-propenoate) |
Synonyms: | 2-Propenoic acid, 2-methyl-, methyl ester, polymer with butyl 2-propenoate and 1,2-propanediol mono(2-methyl-2-propenoate) |
CAS: | 57876-47-8 |
Molecular Formula: | C19H32O7 |
Molecular Weight: | 0 |
InChI: | InChI=1S/C7H12O3.C7H12O2.C5H8O2/c1-5(2)7(9)10-4-6(3)8;1-3-5-6-9-7(8)4-2;1-4(2)5(6)7-3/h6,8H,1,4H2,2-3H3;4H,2-3,5-6H2,1H3;1H2,2-3H3 |
Molecular Structure: |
|
Properties |
Flash Point: | 86.9°C |
Boiling Point: | 218.8°Cat760mmHg |
Density: | g/cm3 |
Flash Point: | 86.9°C |
Safety Data |
|
|