Identification |
Name: | 2-Propenoic acid, 2-methyl-, butyl ester, polymer with methyl 2-methyl-2-propenoate and 1,2-propanediol mono(2-methyl-2-propenoate) |
Synonyms: | 2-Propenoic acid, 2-methyl-, butyl ester, polymer with methyl 2-methyl-2-propenoate and 1,2-propanediol mono(2-methyl-2-propenoate);Methyl methacrylate, butyl methacrylate, hydroxypropyl methacrylatepolymer |
CAS: | 67874-31-1 |
Molecular Formula: | C20H34O7 |
Molecular Weight: | 386.47976 |
InChI: | InChI=1S/C8H14O2.C7H12O3.C5H8O2/c1-4-5-6-10-8(9)7(2)3;1-5(2)7(9)10-4-6(3)8;1-4(2)5(6)7-3/h2,4-6H2,1,3H3;6,8H,1,4H2,2-3H3;1H2,2-3H3 |
Molecular Structure: |
|
Properties |
Flash Point: | 50.6°C |
Boiling Point: | 160°Cat760mmHg |
Density: | g/cm3 |
Flash Point: | 50.6°C |
Safety Data |
|
|