| Identification | |
| Name: | 2-Amino-5-bromobenzoic acid |
| Synonyms: | 5-Bromoanthranilic acid |
| CAS: | 5794-88-7 |
| EINECS: | 227-338-3 |
| Molecular Formula: | C7H6BrNO2 |
| Molecular Weight: | 216.03204 |
| InChI: | InChI=1S/C7H6BrNO2/c8-4-1-2-6(9)5(3-4)7(10)11/h1-3H,9H2,(H,10,11) |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 2811 6.1/PG 3 |
| Density: | 1.793 g/cm3 |
| Stability: | Stable at room temperature in closed containers under normal storage and handling conditions. |
| Solubility: | Soluble |
| Appearance: | White to off white crystalline powder |
| Specification: | slight yellow to white powder Safety Statements:26-36/37-36/37/39 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36/37:Wear suitable protective clothing and gloves 36/37/39:Wear suitable protective clothing, gloves and eye/face protection |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Sensitive: | Light Sensitive |
| Usage: | Determination of cobalt, copper, nickel, and zinc. |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
