| Identification |
| Name: | 4-Bromobenzoic acid |
| Synonyms: | p-Carboxybromobenzene;4-Bromobenzene carboxylic acid;p-Bromobenzoicacid;p-Bromobenzenecarboxylic acid;Benzoic acid, 4-bromo-;4-09-00-01017 (Beilstein Handbook Reference);Benzoic acid, p-bromo-;p-Bromobenzoic acid; |
| CAS: | 586-76-5 |
| EINECS: | 209-581-7 |
| Molecular Formula: | C7H5BrO2 |
| Molecular Weight: | 201.02 |
| InChI: | InChI=1/C7H5BrO2/c8-6-3-1-5(2-4-6)7(9)10/h1-4H,(H,9,10) |
| Molecular Structure: |
 |
| Properties |
| Density: | 1.89 |
| Stability: | Stable. Incompatible with strong oxidizing agents. |
| Refractive index: | 1.608 |
| Water Solubility: | SOLUBLE IN HOT WATER |
| Solubility: | SOLUBLE IN HOT WATER |
| Appearance: | white powder |
| HS Code: | 29163900 |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Usage: | For the detection of strontium. |
| Safety Data |
| Hazard Symbols |
Xn:Harmful
|
| |
 |
