| Identification | |
| Name: | 1H-Benzimidazole,1-ethyl-2-methyl- |
| Synonyms: | Benzimidazole,1-ethyl-2-methyl- (7CI,8CI); 1-Ethyl-2-methylbenzimidazole; NSC 93793 |
| CAS: | 5805-76-5 |
| EINECS: | 227-362-4 |
| Molecular Formula: | C10H12 N2 |
| Molecular Weight: | 160.22 |
| InChI: | InChI=1/C10H12N2/c1-3-12-8(2)11-9-6-4-5-7-10(9)12/h4-7H,3H2,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 135.7°C |
| Boiling Point: | 300.8°C at 760 mmHg |
| Density: | 1.06g/cm3 |
| Refractive index: | 1.582 |
| Specification: |
1H-Benzimidazole,1-ethyl-2-methyl- , its cas register number is 5805-76-5. It also can be called N-Ethyl-2-methylbenzimidazole ; and 1-Ethyl-2-methylbenzimidazole . |
| Flash Point: | 135.7°C |
| Safety Data | |
 |
|
