| Identification | |
| Name: | Phenothiazin-5-ium,3,7-diamino-, chloride (1:1) |
| Synonyms: | 3,7-Diaminophenazathioniumchloride (7CI); Phenothiazin-5-ium, 3,7-diamino-, chloride (8CI,9CI); C.I. 52000;Cyanine; Katalysin; Lauth's violet; Thionin; Thionine |
| CAS: | 581-64-6 |
| EINECS: | 232-648-7 |
| Molecular Formula: | C12H10 N3 S . Cl |
| Molecular Weight: | 263.7459 |
| InChI: | InChI=1S/C12H9N3S.ClH/c13-7-1-3-9-11(5-7)16-12-6-8(14)2-4-10(12)15-9;/h1-6,13H,14H2;1H |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 85.966°C |
| Boiling Point: | 271.606°C at 760 mmHg |
| Density: | 0.983g/cm3 |
| Refractive index: | 1.479 |
| Water Solubility: | H2O: 1 mL/vial |
| Solubility: | H2O: 1 mL/vial |
| Specification: | dark green to black powder or crystals Safety Statements:22-24-26-36/37 22:Do not breathe dust 24:Avoid contact with skin 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36/37:Wear suitable protective clothing and gloves |
| Flash Point: | 85.966°C |
| Storage Temperature: | −20°C |
| Color: | white |
| Safety Data | |
| Hazard Symbols |
Xn: Harmful
|
 |
|
