| Identification | |
| Name: | 2-Naphthylacetic acid |
| Synonyms: | 2-Naphthaleneacetic Acid; beta-Naphthaleneacetic Acid; 2-NAA; 2-Naphthalene acetic acid |
| CAS: | 581-96-4 |
| EINECS: | 209-475-0 |
| Molecular Formula: | C12H10O2 |
| Molecular Weight: | 186.21 |
| InChI: | InChI=1/C12H10O2/c13-12(14)8-9-5-6-10-3-1-2-4-11(10)7-9/h1-7H,8H2,(H,13,14) |
| Molecular Structure: |  |
| Properties | |
| Transport: | 25kgs |
| Density: | 1.233 g/cm3 |
| Stability: | Stable under normal temperatures and pressures. |
| Water Solubility: | insoluble |
| Solubility: | Insoluble |
| Appearance: | white to off white crystals |
| Specification: |
2-Naphthaleneaceticacid , its CAS NO. is 581-96-4, the synonyms are 2-(2-Naphthyl)acetic acid ; Acide beta-naphthylacetique ; Betoxan ; NSC 301 ; beta-Naphthaleneacetic acid ; beta-Naphthylacetic acid . |
| HS Code: | 29163900 |
| Storage Temperature: | Store in a cool, dry place. Keep container closed when not in use. |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
