| Identification |
| Name: | Benzene,1-bromo-2,4-dimethyl- |
| Synonyms: | m-Xylene,4-bromo- (6CI,7CI,8CI);1,3-Dimethyl-4-bromobenzene;1-Bromo-2,4-dimethylbenzene;1-Bromo-2,4-xylene;2,4-Dimethylphenyl bromide;2-Bromo-5-methyltoluene;4-Bromo-1,3-dimethylbenzene;4-Bromo-1,3-xylene;4-Bromo-m-xylene;NSC 64734; |
| CAS: | 583-70-0 |
| EINECS: | 209-517-8 |
| Molecular Formula: | C8H9Br |
| Molecular Weight: | 185.06 |
| InChI: | InChI=1/C8H9Br/c1-6-3-4-8(9)7(2)5-6/h3-5H,1-2H3 |
| Molecular Structure: |
 |
| Properties |
| Melting Point: | -1 |
| Density: | 1.37 |
| Stability: | Stable at room temperature in closed containers under normal storage and handling conditions. |
| Refractive index: | 1.55-1.552 |
| Appearance: | Clear colorless liquid. |
| Packinggroup: | I; II; III |
| Storage Temperature: | Keep away from heat, sparks, and flame. Keep away from sources of ignition. Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Safety Data |
| Hazard Symbols |
Xi:Irritant
|
| |
 |
