Identification |
Name: | 2H-1-Benzopyran-3-aceticacid, 7-hydroxy-4-methyl-2-oxo- |
Synonyms: | 7-Hydroxy-4-methyl-2-oxo-2H-1-benzopyran-3-aceticacid; |
CAS: | 5852-10-8 |
Molecular Formula: | C12H10O5 |
Molecular Weight: | 202.16954 |
InChI: | InChI=1S/C9H6N4O2/c10-4-3-9-11-7-2-1-6(13(14)15)5-8(7)12-9/h1-2,5H,3H2,(H,11,12) |
Molecular Structure: |
|
Properties |
Density: | 1.43 g/cm3 |
Refractive index: | 1.616 |
Water Solubility: | DMF: soluble |
Solubility: | DMF: soluble |
Specification: | Safety Statements:26-36 26:In case of contact with eyes, rinse immediately with plenty
of water and seek medical advice 36:Wear suitable protective clothing |
Safety Data |
Hazard Symbols |
Xi: Irritant
|
|
|