| Identification | |
| Name: | 2H-1-Benzopyran-4-aceticacid, 7-methoxy-2-oxo- |
| Synonyms: | 7-Methoxycoumarin-4-aceticacid; MCA; NSC 378137 |
| CAS: | 62935-72-2 |
| Molecular Formula: | C12H10 O5 |
| Molecular Weight: | 234.2048 |
| InChI: | InChI=1S/C12H10O5/c1-16-8-2-3-9-7(4-11(13)14)5-12(15)17-10(9)6-8/h2-3,5-6H,4H2,1H3,(H,13,14) |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 193 ºC (dec.) |
| Density: | 1.367 g/cm3 |
| Stability: | Moisture, Temperature, Light Sensitive |
| Refractive index: | 1.584 |
| Water Solubility: | Soluble in warm 80% acetic acid (5 mg/ml - clear, colorless solution) |
| Solubility: | Soluble in warm 80% acetic acid (5 mg/ml - clear, colorless solution) |
| Appearance: | Off-white powder |
| Specification: |
2H-1-Benzopyran-4-aceticacid, 7-methoxy-2-oxo- , with CAS number of 62935-72-2, can be called (7-Methoxycoumarin-4-yl)acetic acid ; 7-methoxy-2-oxo-2h-1-benzopyran-4-acetic acid ; 7-methoxycoumarin-4-acetic acid ; mca-oh . 2-Cyclohexen-1-one,3-amino- (CAS NO.5220-49-5) is a light green solid, can be used as coumarin-type fluorescent reagents. |
| Storage Temperature: | 2-8°C |
| Usage: | A precursor to coumarin-type fluorescent reagents |
| Safety Data | |
 |
|
