| Identification | |
| Name: | m-Anisic acid |
| Synonyms: | 3-Methoxybenzoic Acid/m-Methoxybenzoic Acid; meta-anisic acid; 3-Methoxybenzoic acid; M-methoxy benzoic acid |
| CAS: | 586-38-9 |
| EINECS: | 209-574-9 |
| Molecular Formula: | C8H8O3 |
| Molecular Weight: | 152.14732 |
| InChI: | InChI=1S/C8H8O3/c1-11-7-4-2-3-6(5-7)8(9)10/h2-5H,1H3,(H,9,10) |
| Molecular Structure: |  |
| Properties | |
| Transport: | HAZARD |
| Density: | 1.207g/cm3 |
| Stability: | Stable under normal temperatures and pressures. |
| Water Solubility: | AUTOIGNITION |
| Solubility: | AUTOIGNITION |
| Appearance: | White to off-white crystalline powder |
| Specification: | white to light yellow crystal powder Safety Statements:26-36-24/25 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36:Wear suitable protective clothing 24/25:Avoid contact with skin and eyes |
| HS Code: | 29189090 |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
