| Identification | |
| Name: | o-ANISIC ACID, HYDRAZIDE |
| Synonyms: | o-Anisic hydrazide |
| CAS: | 7466-54-8 |
| EINECS: | 231-260-5 |
| Molecular Formula: | C8H10N2O2 |
| Molecular Weight: | 166.17 |
| InChI: | InChI=1/C8H10N2O2/c1-12-7-5-3-2-4-6(7)8(11)10-9/h2-5H,9H2,1H3,(H,10,11) |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 78-80°C |
| Density: | 1.178g/cm3 |
| Refractive index: | 1.558 |
| Specification: |
o-Anisic acid, hydrazide (CAS NO.7466-54-8) is also called 2-Methoxybenzoic acid hydrazide ; 2-Methoxybenzoyl hydrazide ; 2-Methoxybenzoylhydrazide ; 2-Methoxybenzoylhydrazine ; 4-10-00-00199 (Beilstein Handbook Reference) ; BRN 2208367 ; Benzoic acid, o-methoxy-, hydrazide ; Hydrazine, 2-methoxybenzoyl- ; NSC 402658 ; o-Methoxybenzohydrazide ; o-Methoxybenzoic acid hydrazide ; o-Methoxybenzoylhydrazide ; o-Methoxybenzoylhydrazine . o-Anisic acid, hydrazide (CAS NO.7466-54-8) is moderate toxic. It is flammable. It will produce toxic nitrogen oxide fumes when buring. So the storage environment should be ventilate, low-temperature and dry. |
| Safety Data | |
 |
|
