| Identification | |
| Name: | 3-Nitrostyrene |
| Synonyms: | - |
| CAS: | 586-39-0 |
| EINECS: | 209-575-4 |
| Molecular Formula: | C8H7NO2 |
| Molecular Weight: | 149.14668 |
| InChI: | InChI=1S/C8H7NO2/c1-2-7-4-3-5-8(6-7)9(10)11/h2-6H,1H2 |
| Molecular Structure: |  |
| Properties | |
| Transport: | 2810 |
| Boiling Point: | 81-83°C 1mm |
| Density: | 1.07 |
| Stability: | Stable. Combustible. Incompatible with strong oxidizing agents. |
| Refractive index: | 1.582-1.584 |
| Water Solubility: | Stability Stable. Combustible. Incompatible with strong oxidizing agents. Toxicology Skin, eye and respiratory irritant. Toxicology not fully investigated. Toxicity data |
| Solubility: |
|
| Appearance: | liquid |
| Specification: |
3-Nitrostyrene , its cas register number is 586-39-0. It also can be called Benzene,1-ethenyl-3-nitro- ; 1-Ethenyl-3-nitrobenzene ; 1-Vinyl-3-nitrobenzene .It is a clear yellow to light brown liquid. |
| Packinggroup: | III |
| Storage Temperature: | 0-6°C |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
