| Identification | |
| Name: | benzaldehyde azine |
| Synonyms: | Benzaldehyde azine, (Benzalazine); Benzalazine,98%; Benzalazine; Benzylideneazine |
| CAS: | 588-68-1 |
| EINECS: | 209-627-6 |
| Molecular Formula: | C14H12N2 |
| Molecular Weight: | 208.26 |
| InChI: | InChI=1/C14H12N2/c1-3-7-13(8-4-1)11-15-16-12-14-9-5-2-6-10-14/h1-12H |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 92-93 °C(lit.) |
| Flash Point: | 138.3°C |
| Boiling Point: | 318.3°Cat760mmHg |
| Density: | 0.98g/cm3 |
| Refractive index: | 1.56 |
| Specification: | usageEng:Intermediate used in the synthesis of a variety of antibacterial and antifungal activities of symmetric and asymmetric azines. Safety Statements:26-37/39 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 37/39:Wear suitable protective clothing, gloves and eye/face protection |
| Flash Point: | 138.3°C |
| Usage: | Intermediate used in the synthesis of a variety of antibacterial and antifungal activities of symmetric and asymmetric azines. |
| Safety Data | |
 |
|
