| Identification | |
| Name: | Carbamic acid,N-hydroxy-, ethyl ester |
| Synonyms: | Carbamicacid, hydroxy-, ethyl ester (6CI,8CI,9CI); Ethyl N-hydroxycarbamate;Hydroxycarbamic acid ethyl ester; Hydroxyurethane; N-Carbethoxyhydroxylamine;N-Hydroxyurethane; NSC-71045; NSC-83629; SQ 16819 |
| CAS: | 589-41-3 |
| EINECS: | 209-648-0 |
| Molecular Formula: | C3H7 N O3 |
| Molecular Weight: | 105.11 |
| InChI: | InChI=1/C3H7NO3/c1-2-7-3(5)4-6/h6H,2H2,1H3,(H,4,5) |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | >110 ºC |
| Boiling Point: | 113-116 ºC (3 mmHg) |
| Density: | 1.196g/cm3 |
| Refractive index: | 1.445 |
| Specification: | Yellow Oil usageEng:Metabolite of carcinogenic Urethane (U825300). Safety Statements:26-36/37/39 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36/37/39:Wear suitable protective clothing, gloves and eye/face protection |
| Flash Point: | >110 ºC |
| Storage Temperature: | −20°C |
| Usage: | Metabolite of carcinogenic Urethane (U825300). |
| Safety Data | |
 |
|
