| Identification |
| Name: | Butanoic acid,3-methyl-, 2-methylpropyl ester |
| Synonyms: | Isovalericacid, isobutyl ester (6CI,7CI,8CI);2-Methylpropyl 3-methylbutanoate;2-Methylpropyl 3-methylbutyrate;2-Methylpropyl isovalerate;Isobutyl3-methylbutanoate;Isobutyl 3-methylbutyrate;Isobutyl isopentanoate;NSC 6993; |
| CAS: | 589-59-3 |
| EINECS: | 209-653-8 |
| Molecular Formula: | C9H18O2 |
| Molecular Weight: | 158.24 |
| InChI: | InChI=1/C9H18O2/c1-7(2)5-9(10)11-6-8(3)4/h7-8H,5-6H2,1-4H3 |
| Molecular Structure: |
 |
| Properties |
| Density: | 0.853 |
| Refractive index: | 1.406 |
| Solubility: | Insoluble |
| Storage Temperature: | Keep tightly closed. Keep away from heat and open flame. Store in a cool dry place. |
| Usage: | Flavoring and production of fruit essences. |
| Safety Data |
| Hazard Symbols |
Xi:Irritant
|
| |
 |
