| Identification |
| Name: | Butanoic acid, 3-oxo-,2-methylpropyl ester |
| Synonyms: | Acetoaceticacid, isobutyl ester (7CI,8CI);2-Methylpropyl 3-oxobutanoate;Isobutyl3-oxobutanoate;Isobutyl acetoacetate; |
| CAS: | 7779-75-1 |
| EINECS: | 231-937-5 |
| Molecular Formula: | C8H14O3 |
| Molecular Weight: | 158.20 |
| InChI: | InChI=1/C8H14O3/c1-6(2)5-11-8(10)4-7(3)9/h6H,4-5H2,1-3H3 |
| Molecular Structure: |
 |
| Properties |
| Boiling Point: | 100 ºC (22 mmHg) |
| Density: | 0.98 |
| Refractive index: | 1.424 |
| Usage: | Isobutyl acetoacetate is used as intermediate for the production of pharmaceuticals (e.g. Nisoldipine). Product Data Sheet |
| Safety Data |
| |
 |
