| Identification | |
| Name: | 4-Methylcyclohexanone |
| Synonyms: | - |
| CAS: | 589-92-4 |
| EINECS: | 209-665-3 |
| Molecular Formula: | C7H12O |
| Molecular Weight: | 112.17 |
| InChI: | InChI=1/C7H12O/c1-6-2-4-7(8)5-3-6/h6H,2-5H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 2297 3 |
| Density: | 0.914 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.4445-1.4465 |
| Solubility: | Slightly soluble |
| Appearance: | Clear slightly yellow liquid. |
| Report: |
Reported in EPA TSCA Inventory. |
| Packinggroup: | III |
| HS Code: | 29142200 |
| Storage Temperature: | Flammables area |
| Usage: | Intermediates of Liquid Crystals |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
