| Identification | |
| Name: | Bismuth carbonate |
| Synonyms: | Bismuth(III) carbonate basic; Bismuth Subcarbonate; dibismuth carbonate dioxide; Bismuthcarbonatebasic; bismuthyl carbonate |
| CAS: | 5892-10-4 |
| EINECS: | 227-567-9 |
| Molecular Formula: | CBi2O5 |
| Molecular Weight: | 509.96846 |
| InChI: | InChI=1S/CH2O3.2Bi.2O/c2-1(3)4;;;;/h(H2,2,3,4);;;;/q;2*+1;;/p-2 |
| Molecular Structure: |  |
| Properties | |
| Density: | 6.86 |
| Stability: | Stable. |
| Water Solubility: | negligible Stability Stable. Toxicology Irritant. Toxicity data (The meaning of any toxicological abbreviations which appear in this section is given |
| Solubility: | negligible
|
| Appearance: | white to pale yellow powder |
| Specification: |
Product Categories of Bismuth subcarbonate (CAS NO.5892-10-4): Inorganics |
| Packinggroup: | Z01 |
| Storage Temperature: | Keep container tightly closed. Keep container in a cool, well-ventilated area. |
| Usage: | Made into nanotube arrays that exhibit antibacterial properties. Used in firework. |
| Safety Data | |
 |
|
