| Identification | |
| Name: | 1,1'-Biphenyl,2,4,6-tribromo- |
| Synonyms: | Biphenyl,2,4,6-tribromo- (7CI); 2,4,6-Tribromobiphenyl; PBB 30 |
| CAS: | 59080-33-0 |
| Molecular Formula: | C12H7 Br3 |
| Molecular Weight: | 390.9 |
| InChI: | InChI=1/C12H7Br3/c13-9-6-10(14)12(11(15)7-9)8-4-2-1-3-5-8/h1-7H |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 170.8°C |
| Boiling Point: | 366.7°C at 760 mmHg |
| Density: | 1.923g/cm3 |
| Refractive index: | 1.647 |
| Specification: |
1,3,5-Tribromo-2-phenylbenzene with CAS number of 59080-33-0 is also named as PBB NO 30 ; PBB-30 ; 2,4,6-Tribromobiphenyl . |
| Flash Point: | 170.8°C |
| Safety Data | |
 |
|
