| Identification | |
| Name: | 2,3-dimethylpyrazine |
| Synonyms: | 2,3-Dimethyl pyrazine; 2,3-Dimethyl-1,4-diazine |
| CAS: | 5910-89-4 |
| EINECS: | 227-630-0 |
| Molecular Formula: | C6H8N2 |
| Molecular Weight: | 108.14 |
| InChI: | InChI=1/C6H8N2/c1-5-6(2)8-4-3-7-5/h3-4H,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 1993 3/PG 3 |
| Density: | 1.02 |
| Stability: | No data. |
| Refractive index: | 1.506-1.508 |
| Solubility: | Miscible. |
| Appearance: | Clear, yellow liquid. with a nutty odor. |
| Packinggroup: | III |
| HS Code: | 29339990 |
| Storage Temperature: | Flammables area |
| Usage: | A component of the aroma of roasted sesame seeds. |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
