| Identification | |
| Name: | Methylcarbamoylethyl acrylate |
| Synonyms: | Acrylic acid 2-(methylcarbamoyl)ethyl ester |
| CAS: | 59163-97-2 |
| Molecular Formula: | C7H11NO3 |
| Molecular Weight: | 0 |
| InChI: | InChI=1/C7H11NO3/c1-3-7(10)11-5-4-6(9)8-2/h3H,1,4-5H2,2H3,(H,8,9) |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 149.4°C |
| Boiling Point: | 323.4°C at 760 mmHg |
| Density: | 1.057g/cm3 |
| Refractive index: | 1.445 |
| Specification: |
Methylcarbamoylethyl acrylate , its cas register number is 59163-97-2. It also can be called Methylcarbamylethyl acrylate ; and Acrylic acid, methylcarbamylethyl ester . Its classification code is Skin / Eye Irritant. |
| Flash Point: | 149.4°C |
| Safety Data | |
 |
|
