| Identification | |
| Name: | 3-Pyridinebutanol, d-(methylnitrosoamino)- |
| Synonyms: | Iso-NNAL |
| CAS: | 59578-66-4 |
| Molecular Formula: | C10H15 N3 O2 |
| Molecular Weight: | 0 |
| InChI: | InChI=1/C10H15N3O2/c1-13(12-15)10(5-3-7-14)9-4-2-6-11-8-9/h2,4,6,8,10,14H,3,5,7H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 213.2°C |
| Boiling Point: | 428.9°C at 760 mmHg |
| Density: | 1.16g/cm3 |
| Refractive index: | 1.557 |
| Specification: | Yellow Oil usageEng:A toxic and carcinogenic agent in dry and moist snuff |
| Flash Point: | 213.2°C |
| Storage Temperature: | Refrigerator |
| Usage: | A toxic and carcinogenic agent in dry and moist snuff |
| Safety Data | |
 |
|
