| Identification | |
| Name: | 3-Pyridinemethanol, a-[3-(methylnitrosoamino)propyl]- |
| CAS: | 76014-81-8 |
| Molecular Formula: | C10H15 N3 O2 |
| Molecular Weight: | 209.28 |
| InChI: | InChI=1/C10H15N3O2/c1-13(12-15)7-3-5-10(14)9-4-2-6-11-8-9/h2,4,6,8,10,14H,3,5,7H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 214°C |
| Boiling Point: | 430.2°C at 760 mmHg |
| Density: | 1.16g/cm3 |
| Refractive index: | 1.557 |
| Specification: |
4-(Methylnitrosoamino)-1-(3-pyridyl)-1-butanol (CAS NO.76014-81-8) is also called as CCRIS 3049 ; alpha-(3-(Methylnitrosoamino)propyl)-3-pyridinemethanol ; 3-Pyridinemethanol, alpha-(3-(methylnitrosoamino)propyl)- . |
| Flash Point: | 214°C |
| Storage Temperature: | 2-8°C |
| Usage: |
4-(Methylnitrosoamino)-1-(3-pyridyl)-1-butanol (CAS NO.76014-81-8) can be used as a metabolite of NNK (Cat. #M325750), a tobacco-specific nitrosamine . |
| Safety Data | |
 |
|
