| Identification | |
| Name: | Bromoacetyl bromide |
| Synonyms: | Acetyl bromide, bromo-;2-Bromoacetyl bromide; |
| CAS: | 598-21-0 |
| EINECS: | 209-923-5 |
| Molecular Formula: | C2H2Br2O |
| Molecular Weight: | 201.84 |
| InChI: | InChI=1/C2H2Br2O/c3-1-2(4)5/h1H2 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 2513 |
| Flash Point: | > 110 C |
| Density: | 2.317 |
| Stability: | Stable, but reacts violently with water. Incompatible with water, moisture, alcohols, strong bases, strong oxidizing agents. |
| Refractive index: | 1.545-1.547 |
| Water Solubility: | REACTS |
| Solubility: | reactively Combines with water |
| Appearance: | clear to yellow liquid |
| Packinggroup: | II |
| HS Code: | 29159080 |
| Flash Point: | > 110 C |
| Sensitive: | Moisture Sensitive |
| Usage: | Used to make other chemicals. |
| Safety Data | |
| Hazard Symbols |
C:Corrosive
|
 |
|
